C16H21N5O4S — CID 71554052
[3-[[4-(butan-2-ylamino)-5-carbamoylpyrimidin-2-yl]amino]phenyl] methanesulfonate (PubChem CID 71554052) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is [3-[[4-(butan-2-ylamino)-5-carbamoylpyrimidin-2-yl]amino]phenyl] methanesulfonate.
| Compound Name | [3-[[4-(butan-2-ylamino)-5-carbamoylpyrimidin-2-yl]amino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 71554052 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [3-[[4-(butan-2-ylamino)-5-carbamoylpyrimidin-2-yl]amino]phenyl] methanesulfonate |
| SMILES | CCC(C)Nc1nc(Nc2cccc(OS(C)(=O)=O)c2)ncc1C(N)=O |
| InChI | InChI=1S/C16H21N5O4S/c1-4-10(2)19-15-13(14(17)22)9-18-16(21-15)20-11-6-5-7-12(8-11)25-26(3,23)24/h5-10H,4H2,1-3H3,(H2,17,22)(H2,18,19,20,21) |
| InChIKey | LKBHWVRLTNQEPM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|