C21H29ClO2 — CID 71554458
1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-3-hydroxy-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 71554458) has the molecular formula C21H29ClO2 and a molecular weight of 348.91 g/mol. Its IUPAC name is 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-3-hydroxy-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-3-hydroxy-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 71554458 |
| Molecular Formula | C21H29ClO2 |
| Molecular Weight | 348.91 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-[(3R,5R,8R,9R,10S,13S,14S,17S)-3-(2-chloroethynyl)-3-hydroxy-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(C#CCl)CC[C@@H]4[C@H]3CC[C@@H]21 |
| InChI | InChI=1S/C21H29ClO2/c1-13(23)15-4-5-20-17(15)6-7-18-16-8-9-21(24,10-11-22)12-14(16)2-3-19(18)20/h14-20,24H,2-9,12H2,1H3/t14-,15-,16+,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | GSUJIQUXJJSTPQ-FQOJGSFKSA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|