C17H14F3NO2 — CID 71555740
3-[(R)-hydroxy(pyridin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one (PubChem CID 71555740) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 3-[(R)-hydroxy(pyridin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one.
| Compound Name | 3-[(R)-hydroxy(pyridin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 71555740 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-[(R)-hydroxy(pyridin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one |
| SMILES | O=C1CC(c2cccc(C(F)(F)F)c2)([C@@H](O)c2ccccn2)C1 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)12-5-3-4-11(8-12)16(9-13(22)10-16)15(23)14-6-1-2-7-21-14/h1-8,15,23H,9-10H2/t15-/m0/s1 |
| InChIKey | PRZCHPOZAUZOJS-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |