C29H33N7O — CID 71558473
2-hexyl-3-[[1-[2-(2H-tetrazol-5-yl)phenyl]indol-4-yl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 71558473) has the molecular formula C29H33N7O and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-hexyl-3-[[1-[2-(2H-tetrazol-5-yl)phenyl]indol-4-yl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one.
| Compound Name | 2-hexyl-3-[[1-[2-(2H-tetrazol-5-yl)phenyl]indol-4-yl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one |
|---|---|
| PubChem CID | 71558473 |
| Molecular Formula | C29H33N7O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 2-hexyl-3-[[1-[2-(2H-tetrazol-5-yl)phenyl]indol-4-yl]methyl]-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | CCCCCCC1=NC2(CCCC2)C(=O)N1Cc1cccc2c1ccn2-c1ccccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C29H33N7O/c1-2-3-4-5-15-26-30-29(17-8-9-18-29)28(37)36(26)20-21-11-10-14-24-22(21)16-19-35(24)25-13-7-6-12-23(25)27-31-33-34-32-27/h6-7,10-14,16,19H,2-5,8-9,15,17-18,20H2,1H3,(H,31,32,33,34) |
| InChIKey | QEBWXWAEGCRSQH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|