C12H16NNaO6 — CID 71558959
sodium (3aR,7S,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 71558959) has the molecular formula C12H16NNaO6 and a molecular weight of 293.25 g/mol. Its IUPAC name is sodium (3aR,7S,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | sodium (3aR,7S,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 71558959 |
| Molecular Formula | C12H16NNaO6 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | sodium (3aR,7S,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CC(=O)N[C@@H]1C(O)=CC(C(=O)[O-])[C@H]2OC(C)(C)O[C@@H]12.[Na+] |
| InChI | InChI=1S/C12H17NO6.Na/c1-5(14)13-8-7(15)4-6(11(16)17)9-10(8)19-12(2,3)18-9;/h4,6,8-10,15H,1-3H3,(H,13,14)(H,16,17);/q;+1/p-1/t6?,8-,9-,10+;/m1./s1 |
| InChIKey | CVFBEESAZVFILK-FPIDVOHLSA-M |
| XLogP | -4.16 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |