C14H20N2O6 — CID 87263067
ethyl (7aS)-7-acetamido-6-hydroxyimino-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 87263067) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is ethyl (7aS)-7-acetamido-6-hydroxyimino-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (7aS)-7-acetamido-6-hydroxyimino-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 87263067 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl (7aS)-7-acetamido-6-hydroxyimino-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=CC(=NO)C(NC(C)=O)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C14H20N2O6/c1-5-20-13(18)8-6-9(16-19)10(15-7(2)17)12-11(8)21-14(3,4)22-12/h6,10-12,19H,5H2,1-4H3,(H,15,17)/t10?,11?,12-/m0/s1 |
| InChIKey | XZLDQWNCJXNILN-MCIGGMRASA-N |
| XLogP | 0.34 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|