C29H25F3N2O5 — CID 71559804
ethyl (7S,9R,10S,14R,15S)-5,11,13-trioxo-12-phenyl-15-[4-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate (PubChem CID 71559804) has the molecular formula C29H25F3N2O5 and a molecular weight of 538.52 g/mol. Its IUPAC name is ethyl (7S,9R,10S,14R,15S)-5,11,13-trioxo-12-phenyl-15-[4-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate.
| Compound Name | ethyl (7S,9R,10S,14R,15S)-5,11,13-trioxo-12-phenyl-15-[4-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate |
|---|---|
| PubChem CID | 71559804 |
| Molecular Formula | C29H25F3N2O5 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | ethyl (7S,9R,10S,14R,15S)-5,11,13-trioxo-12-phenyl-15-[4-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]3CC(=O)C=C3CN1[C@H](c1ccc(C(F)(F)F)cc1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C29H25F3N2O5/c1-2-39-27(38)28-14-17-12-21(35)13-18(17)15-33(28)24(16-8-10-19(11-9-16)29(30,31)32)22-23(28)26(37)34(25(22)36)20-6-4-3-5-7-20/h3-11,13,17,22-24H,2,12,14-15H2,1H3/t17-,22-,23-,24-,28-/m1/s1 |
| InChIKey | OWZOVABNEPEVMR-FQXHTDITSA-N |
| XLogP | 4.09 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|