C29H28N2O6 — CID 71560506
ethyl (7S,9R,10S,14R,15S)-15-(4-methoxyphenyl)-5,11,13-trioxo-12-phenyl-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate (PubChem CID 71560506) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is ethyl (7S,9R,10S,14R,15S)-15-(4-methoxyphenyl)-5,11,13-trioxo-12-phenyl-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate.
| Compound Name | ethyl (7S,9R,10S,14R,15S)-15-(4-methoxyphenyl)-5,11,13-trioxo-12-phenyl-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate |
|---|---|
| PubChem CID | 71560506 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | ethyl (7S,9R,10S,14R,15S)-15-(4-methoxyphenyl)-5,11,13-trioxo-12-phenyl-1,12-diazatetracyclo[7.6.0.03,7.010,14]pentadec-3-ene-9-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]3CC(=O)C=C3CN1[C@H](c1ccc(OC)cc1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C29H28N2O6/c1-3-37-28(35)29-15-18-13-21(32)14-19(18)16-30(29)25(17-9-11-22(36-2)12-10-17)23-24(29)27(34)31(26(23)33)20-7-5-4-6-8-20/h4-12,14,18,23-25H,3,13,15-16H2,1-2H3/t18-,23-,24-,25-,29-/m1/s1 |
| InChIKey | VLLDKOPPGPQDLX-ZULUUIFLSA-N |
| XLogP | 3.08 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|