C19H16N6O2 — CID 71562691
(4-methoxyphenyl)-(6-phenylmethoxy-7H-purin-2-yl)diazene (PubChem CID 71562691) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is (4-methoxyphenyl)-(6-phenylmethoxy-7H-purin-2-yl)diazene.
| Compound Name | (4-methoxyphenyl)-(6-phenylmethoxy-7H-purin-2-yl)diazene |
|---|---|
| PubChem CID | 71562691 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (4-methoxyphenyl)-(6-phenylmethoxy-7H-purin-2-yl)diazene |
| SMILES | COc1ccc(/N=N/c2nc(OCc3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C19H16N6O2/c1-26-15-9-7-14(8-10-15)24-25-19-22-17-16(20-12-21-17)18(23-19)27-11-13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H,20,21,22,23)/b25-24+ |
| InChIKey | OFNPKAGIHCKIAH-OCOZRVBESA-N |
| XLogP | 4.36 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|