C22H19N7O5 — CID 11397044
methyl 4-[methyl-[(E)-(6-phenylmethoxy-7H-purin-2-yl)diazenyl]carbamoyl]oxybenzoate (PubChem CID 11397044) has the molecular formula C22H19N7O5 and a molecular weight of 461.44 g/mol. Its IUPAC name is methyl 4-[methyl-[(E)-(6-phenylmethoxy-7H-purin-2-yl)diazenyl]carbamoyl]oxybenzoate.
| Compound Name | methyl 4-[methyl-[(E)-(6-phenylmethoxy-7H-purin-2-yl)diazenyl]carbamoyl]oxybenzoate |
|---|---|
| PubChem CID | 11397044 |
| Molecular Formula | C22H19N7O5 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 4-[methyl-[(E)-(6-phenylmethoxy-7H-purin-2-yl)diazenyl]carbamoyl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)N(C)/N=N/c2nc(OCc3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C22H19N7O5/c1-29(22(31)34-16-10-8-15(9-11-16)20(30)32-2)28-27-21-25-18-17(23-13-24-18)19(26-21)33-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3,(H,23,24,25,26)/b28-27+ |
| InChIKey | ZYDKPPNGLJIXJJ-BYYHNAKLSA-N |
| XLogP | 3.85 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|