C20H15N5O4 — CID 175814520
benzyl N-benzoyl-N-(6-oxo-1,7-dihydropurin-2-yl)carbamate (PubChem CID 175814520) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is benzyl N-benzoyl-N-(6-oxo-1,7-dihydropurin-2-yl)carbamate.
| Compound Name | benzyl N-benzoyl-N-(6-oxo-1,7-dihydropurin-2-yl)carbamate |
|---|---|
| PubChem CID | 175814520 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | benzyl N-benzoyl-N-(6-oxo-1,7-dihydropurin-2-yl)carbamate |
| SMILES | O=C(OCc1ccccc1)N(C(=O)c1ccccc1)c1nc2nc[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H15N5O4/c26-17-15-16(22-12-21-15)23-19(24-17)25(18(27)14-9-5-2-6-10-14)20(28)29-11-13-7-3-1-4-8-13/h1-10,12H,11H2,(H2,21,22,23,24,26) |
| InChIKey | XEKSWHLGKBLNHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |