C20H29N3O4S — CID 71562728
8-(methanesulfonamido)-N-[(2S)-nonan-2-yl]-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 71562728) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 8-(methanesulfonamido)-N-[(2S)-nonan-2-yl]-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | 8-(methanesulfonamido)-N-[(2S)-nonan-2-yl]-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71562728 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 8-(methanesulfonamido)-N-[(2S)-nonan-2-yl]-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | CCCCCCC[C@H](C)NC(=O)c1cc(=O)c2cccc(NS(C)(=O)=O)c2[nH]1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-5-6-7-8-10-14(2)21-20(25)17-13-18(24)15-11-9-12-16(19(15)22-17)23-28(3,26)27/h9,11-14,23H,4-8,10H2,1-3H3,(H,21,25)(H,22,24)/t14-/m0/s1 |
| InChIKey | ZRIUNLGFLWTKPX-AWEZNQCLSA-N |
| XLogP | 3.38 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|