C17H15N3O5S — CID 71562973
N-(2-hydroxyphenyl)-8-(methanesulfonamido)-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 71562973) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-8-(methanesulfonamido)-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-8-(methanesulfonamido)-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71562973 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(2-hydroxyphenyl)-8-(methanesulfonamido)-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc2c(=O)cc(C(=O)Nc3ccccc3O)[nH]c12 |
| InChI | InChI=1S/C17H15N3O5S/c1-26(24,25)20-12-7-4-5-10-15(22)9-13(18-16(10)12)17(23)19-11-6-2-3-8-14(11)21/h2-9,20-21H,1H3,(H,18,22)(H,19,23) |
| InChIKey | XMFWVNIKJZILRH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|