C17H17N3O3 — CID 143597076
N-[(2Z,4Z)-2-aminohepta-2,4,6-trien-3-yl]-8-hydroxy-4-oxo-1H-quinoline-2-carboxamide (PubChem CID 143597076) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-aminohepta-2,4,6-trien-3-yl]-8-hydroxy-4-oxo-1H-quinoline-2-carboxamide.
| Compound Name | N-[(2Z,4Z)-2-aminohepta-2,4,6-trien-3-yl]-8-hydroxy-4-oxo-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 143597076 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[(2Z,4Z)-2-aminohepta-2,4,6-trien-3-yl]-8-hydroxy-4-oxo-1H-quinoline-2-carboxamide |
| SMILES | C=C/C=C\C(NC(=O)c1cc(=O)c2cccc(O)c2[nH]1)=C(/C)N |
| InChI | InChI=1S/C17H17N3O3/c1-3-4-7-12(10(2)18)20-17(23)13-9-15(22)11-6-5-8-14(21)16(11)19-13/h3-9,21H,1,18H2,2H3,(H,19,22)(H,20,23)/b7-4-,12-10- |
| InChIKey | LGGQJXJTYAAUOJ-BXOIZCENSA-N |
| XLogP | 1.90 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|