C12H10N2O8S — CID 163041158
2-[(4-oxo-8-sulfooxy-1H-quinoline-2-carbonyl)amino]acetic acid (PubChem CID 163041158) has the molecular formula C12H10N2O8S and a molecular weight of 342.29 g/mol. Its IUPAC name is 2-[(4-oxo-8-sulfooxy-1H-quinoline-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(4-oxo-8-sulfooxy-1H-quinoline-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 163041158 |
| Molecular Formula | C12H10N2O8S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[(4-oxo-8-sulfooxy-1H-quinoline-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(=O)c2cccc(OS(=O)(=O)O)c2[nH]1 |
| InChI | InChI=1S/C12H10N2O8S/c15-8-4-7(12(18)13-5-10(16)17)14-11-6(8)2-1-3-9(11)22-23(19,20)21/h1-4H,5H2,(H,13,18)(H,14,15)(H,16,17)(H,19,20,21) |
| InChIKey | QAKOVTBNFNRCKH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 162.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|