C23H23N3O6S — CID 504870
(4S)-4-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-5-oxo-5-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethylamino]pentanoic acid (PubChem CID 504870) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is (4S)-4-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-5-oxo-5-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethylamino]pentanoic acid.
| Compound Name | (4S)-4-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-5-oxo-5-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 504870 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (4S)-4-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-5-oxo-5-[2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)ethylamino]pentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cc(=O)c2cccc(O)c2[nH]1)C(=O)NCCC1=CC=CCC1=S |
| InChI | InChI=1S/C23H23N3O6S/c27-17-6-3-5-14-18(28)12-16(25-21(14)17)23(32)26-15(8-9-20(29)30)22(31)24-11-10-13-4-1-2-7-19(13)33/h1-6,12,15,27H,7-11H2,(H,24,31)(H,25,28)(H,26,32)(H,29,30)/t15-/m0/s1 |
| InChIKey | KHULDIPQQGXBCB-HNNXBMFYSA-N |
| XLogP | 1.96 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|