C42H38N4O7 — CID 10169064
(2S)-N-[(3,4-dihydroxyphenyl)methyl]-2-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide (PubChem CID 10169064) has the molecular formula C42H38N4O7 and a molecular weight of 710.79 g/mol. Its IUPAC name is (2S)-N-[(3,4-dihydroxyphenyl)methyl]-2-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide.
| Compound Name | (2S)-N-[(3,4-dihydroxyphenyl)methyl]-2-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide |
|---|---|
| PubChem CID | 10169064 |
| Molecular Formula | C42H38N4O7 |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 710.27 |
| IUPAC Name | (2S)-N-[(3,4-dihydroxyphenyl)methyl]-2-[(8-hydroxy-4-oxo-1H-quinoline-2-carbonyl)amino]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide |
| SMILES | Cc1ccc(C(NC(=O)CC[C@H](NC(=O)c2cc(=O)c3cccc(O)c3[nH]2)C(=O)NCc2ccc(O)c(O)c2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H38N4O7/c1-26-15-18-30(19-16-26)42(28-9-4-2-5-10-28,29-11-6-3-7-12-29)46-38(51)22-20-32(40(52)43-25-27-17-21-34(47)37(50)23-27)45-41(53)33-24-36(49)31-13-8-14-35(48)39(31)44-33/h2-19,21,23-24,32,47-48,50H,20,22,25H2,1H3,(H,43,52)(H,44,49)(H,45,53)(H,46,51)/t32-/m0/s1 |
| InChIKey | PKSYOBODYYVCRM-YTTGMZPUSA-N |
| XLogP | 5.26 |
| TPSA | 180.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|