C39H37N3O7 — CID 10211757
(2S)-2-[(3,4-dihydroxybenzoyl)amino]-N-[(3,4-dihydroxyphenyl)methyl]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide (PubChem CID 10211757) has the molecular formula C39H37N3O7 and a molecular weight of 659.74 g/mol. Its IUPAC name is (2S)-2-[(3,4-dihydroxybenzoyl)amino]-N-[(3,4-dihydroxyphenyl)methyl]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide.
| Compound Name | (2S)-2-[(3,4-dihydroxybenzoyl)amino]-N-[(3,4-dihydroxyphenyl)methyl]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide |
|---|---|
| PubChem CID | 10211757 |
| Molecular Formula | C39H37N3O7 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | (2S)-2-[(3,4-dihydroxybenzoyl)amino]-N-[(3,4-dihydroxyphenyl)methyl]-N'-[(4-methylphenyl)-diphenylmethyl]pentanediamide |
| SMILES | Cc1ccc(C(NC(=O)CC[C@H](NC(=O)c2ccc(O)c(O)c2)C(=O)NCc2ccc(O)c(O)c2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H37N3O7/c1-25-12-16-30(17-13-25)39(28-8-4-2-5-9-28,29-10-6-3-7-11-29)42-36(47)21-18-31(41-37(48)27-15-20-33(44)35(46)23-27)38(49)40-24-26-14-19-32(43)34(45)22-26/h2-17,19-20,22-23,31,43-46H,18,21,24H2,1H3,(H,40,49)(H,41,48)(H,42,47)/t31-/m0/s1 |
| InChIKey | HHWSKWHUFNXULV-HKBQPEDESA-N |
| XLogP | 5.12 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|