C24H27BrN4O4 — CID 11272289
(2S)-N-benzyl-2-[(4-bromo-1H-indole-2-carbonyl)amino]-N'-hydroxyoctanediamide (PubChem CID 11272289) has the molecular formula C24H27BrN4O4 and a molecular weight of 515.41 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(4-bromo-1H-indole-2-carbonyl)amino]-N'-hydroxyoctanediamide.
| Compound Name | (2S)-N-benzyl-2-[(4-bromo-1H-indole-2-carbonyl)amino]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 11272289 |
| Molecular Formula | C24H27BrN4O4 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | (2S)-N-benzyl-2-[(4-bromo-1H-indole-2-carbonyl)amino]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCC[C@H](NC(=O)c1cc2c(Br)cccc2[nH]1)C(=O)NCc1ccccc1)NO |
| InChI | InChI=1S/C24H27BrN4O4/c25-18-10-7-12-19-17(18)14-21(27-19)24(32)28-20(11-5-2-6-13-22(30)29-33)23(31)26-15-16-8-3-1-4-9-16/h1,3-4,7-10,12,14,20,27,33H,2,5-6,11,13,15H2,(H,26,31)(H,28,32)(H,29,30)/t20-/m0/s1 |
| InChIKey | IEHKVUQEBWCOCC-FQEVSTJZSA-N |
| XLogP | 3.80 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|