C29H36N4O4 — CID 11318087
(2S)-N-(1-benzylcyclopentyl)-N'-hydroxy-2-(1H-indole-2-carbonylamino)octanediamide (PubChem CID 11318087) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is (2S)-N-(1-benzylcyclopentyl)-N'-hydroxy-2-(1H-indole-2-carbonylamino)octanediamide.
| Compound Name | (2S)-N-(1-benzylcyclopentyl)-N'-hydroxy-2-(1H-indole-2-carbonylamino)octanediamide |
|---|---|
| PubChem CID | 11318087 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (2S)-N-(1-benzylcyclopentyl)-N'-hydroxy-2-(1H-indole-2-carbonylamino)octanediamide |
| SMILES | O=C(CCCCC[C@H](NC(=O)c1cc2ccccc2[nH]1)C(=O)NC1(Cc2ccccc2)CCCC1)NO |
| InChI | InChI=1S/C29H36N4O4/c34-26(33-37)16-6-2-5-15-24(31-27(35)25-19-22-13-7-8-14-23(22)30-25)28(36)32-29(17-9-10-18-29)20-21-11-3-1-4-12-21/h1,3-4,7-8,11-14,19,24,30,37H,2,5-6,9-10,15-18,20H2,(H,31,35)(H,32,36)(H,33,34)/t24-/m0/s1 |
| InChIKey | YJENJZLTLUSZED-DEOSSOPVSA-N |
| XLogP | 4.39 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|