C22H23N3O3 — CID 71565593
7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methylcyclohexen-1-yl)quinoline-2-carboxamide (PubChem CID 71565593) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methylcyclohexen-1-yl)quinoline-2-carboxamide.
| Compound Name | 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methylcyclohexen-1-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71565593 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 7-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methylcyclohexen-1-yl)quinoline-2-carboxamide |
| SMILES | CC1CC=C(c2cc(C(N)=O)nc3cc(CN4C(=O)CCC4=O)ccc23)CC1 |
| InChI | InChI=1S/C22H23N3O3/c1-13-2-5-15(6-3-13)17-11-19(22(23)28)24-18-10-14(4-7-16(17)18)12-25-20(26)8-9-21(25)27/h4-5,7,10-11,13H,2-3,6,8-9,12H2,1H3,(H2,23,28) |
| InChIKey | PQQJZVOILCUNMH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|