C11H17F3O — CID 71569631
(E)-4-[(E)-3,3,3-trifluoroprop-1-enoxy]oct-2-ene (PubChem CID 71569631) has the molecular formula C11H17F3O and a molecular weight of 222.25 g/mol. Its IUPAC name is (E)-4-[(E)-3,3,3-trifluoroprop-1-enoxy]oct-2-ene.
| Compound Name | (E)-4-[(E)-3,3,3-trifluoroprop-1-enoxy]oct-2-ene |
|---|---|
| PubChem CID | 71569631 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (E)-4-[(E)-3,3,3-trifluoroprop-1-enoxy]oct-2-ene |
| SMILES | C/C=C/C(CCCC)O/C=C/C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-3-5-7-10(6-4-2)15-9-8-11(12,13)14/h4,6,8-10H,3,5,7H2,1-2H3/b6-4+,9-8+ |
| InChIKey | UQZUVUFUVNWWMI-ICNYKPIKSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|