C15H24F2O2 — CID 144515538
(3Z,8E)-11,11-difluoro-7-methoxy-3-methyl-1-oxacyclotetradeca-3,8-diene (PubChem CID 144515538) has the molecular formula C15H24F2O2 and a molecular weight of 274.35 g/mol. Its IUPAC name is (3Z,8E)-11,11-difluoro-7-methoxy-3-methyl-1-oxacyclotetradeca-3,8-diene.
| Compound Name | (3Z,8E)-11,11-difluoro-7-methoxy-3-methyl-1-oxacyclotetradeca-3,8-diene |
|---|---|
| PubChem CID | 144515538 |
| Molecular Formula | C15H24F2O2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (3Z,8E)-11,11-difluoro-7-methoxy-3-methyl-1-oxacyclotetradeca-3,8-diene |
| SMILES | COC1/C=C/CC(F)(F)CCCOC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H24F2O2/c1-13-6-3-7-14(18-2)8-4-9-15(16,17)10-5-11-19-12-13/h4,6,8,14H,3,5,7,9-12H2,1-2H3/b8-4+,13-6- |
| InChIKey | OSIRTJVDTQNUHR-QKOXHABLSA-N |
| XLogP | 4.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|