C16H16O5 — CID 71572067
3a-acetyl-3-(4-methoxyphenyl)-3,6-dihydro-1H-furo[3,4-c]pyran-4-one (PubChem CID 71572067) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3a-acetyl-3-(4-methoxyphenyl)-3,6-dihydro-1H-furo[3,4-c]pyran-4-one.
| Compound Name | 3a-acetyl-3-(4-methoxyphenyl)-3,6-dihydro-1H-furo[3,4-c]pyran-4-one |
|---|---|
| PubChem CID | 71572067 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3a-acetyl-3-(4-methoxyphenyl)-3,6-dihydro-1H-furo[3,4-c]pyran-4-one |
| SMILES | COc1ccc(C2OCC3=CCOC(=O)C32C(C)=O)cc1 |
| InChI | InChI=1S/C16H16O5/c1-10(17)16-12(7-8-20-15(16)18)9-21-14(16)11-3-5-13(19-2)6-4-11/h3-7,14H,8-9H2,1-2H3 |
| InChIKey | QIFYTFHXXWADBP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|