C11H10BrIO2 — CID 46915109
4-bromo-3-iodo-2-(4-methoxyphenyl)-2,5-dihydrofuran (PubChem CID 46915109) has the molecular formula C11H10BrIO2 and a molecular weight of 381.01 g/mol. Its IUPAC name is 4-bromo-3-iodo-2-(4-methoxyphenyl)-2,5-dihydrofuran.
| Compound Name | 4-bromo-3-iodo-2-(4-methoxyphenyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 46915109 |
| Molecular Formula | C11H10BrIO2 |
| Molecular Weight | 381.01 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | 4-bromo-3-iodo-2-(4-methoxyphenyl)-2,5-dihydrofuran |
| SMILES | COc1ccc(C2OCC(Br)=C2I)cc1 |
| InChI | InChI=1S/C11H10BrIO2/c1-14-8-4-2-7(3-5-8)11-10(13)9(12)6-15-11/h2-5,11H,6H2,1H3 |
| InChIKey | SOWQUSNNIHJENN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|