C6H8NO4- — CID 7157246
(2S,3S)-3-(carboxylatomethyl)azetidin-1-ium-2-carboxylate (PubChem CID 7157246) has the molecular formula C6H8NO4- and a molecular weight of 158.13 g/mol. Its IUPAC name is (2S,3S)-3-(carboxylatomethyl)azetidin-1-ium-2-carboxylate.
| Compound Name | (2S,3S)-3-(carboxylatomethyl)azetidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7157246 |
| Molecular Formula | C6H8NO4- |
| Molecular Weight | 158.13 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (2S,3S)-3-(carboxylatomethyl)azetidin-1-ium-2-carboxylate |
| SMILES | O=C([O-])C[C@H]1C[NH2+][C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C6H9NO4/c8-4(9)1-3-2-7-5(3)6(10)11/h3,5,7H,1-2H2,(H,8,9)(H,10,11)/p-1/t3-,5-/m0/s1 |
| InChIKey | FQUPICCTRPWMDZ-UCORVYFPSA-M |
| XLogP | -4.56 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.13 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |