C14H21ClN2O2 — CID 71582264
(2R,3R)-3-chloro-N,N,2-trimethyl-3-(3-nitrophenyl)pentan-1-amine (PubChem CID 71582264) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (2R,3R)-3-chloro-N,N,2-trimethyl-3-(3-nitrophenyl)pentan-1-amine.
| Compound Name | (2R,3R)-3-chloro-N,N,2-trimethyl-3-(3-nitrophenyl)pentan-1-amine |
|---|---|
| PubChem CID | 71582264 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2R,3R)-3-chloro-N,N,2-trimethyl-3-(3-nitrophenyl)pentan-1-amine |
| SMILES | CC[C@](Cl)(c1cccc([N+](=O)[O-])c1)[C@H](C)CN(C)C |
| InChI | InChI=1S/C14H21ClN2O2/c1-5-14(15,11(2)10-16(3)4)12-7-6-8-13(9-12)17(18)19/h6-9,11H,5,10H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | ACHOBZTWABYQJR-BXUZGUMPSA-N |
| XLogP | 3.64 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|