C22H22N4O4S3 — CID 71588343
2-[[(5E)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-N-(4-hydroxyphenyl)-2-sulfanylideneacetamide (PubChem CID 71588343) has the molecular formula C22H22N4O4S3 and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-[[(5E)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-N-(4-hydroxyphenyl)-2-sulfanylideneacetamide.
| Compound Name | 2-[[(5E)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-N-(4-hydroxyphenyl)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 71588343 |
| Molecular Formula | C22H22N4O4S3 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-[[(5E)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-N-(4-hydroxyphenyl)-2-sulfanylideneacetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=S)N(NC(=S)C(=O)Nc3ccc(O)cc3)C2=O)c(O)c1 |
| InChI | InChI=1S/C22H22N4O4S3/c1-3-25(4-2)15-8-5-13(17(28)12-15)11-18-21(30)26(22(32)33-18)24-20(31)19(29)23-14-6-9-16(27)10-7-14/h5-12,27-28H,3-4H2,1-2H3,(H,23,29)(H,24,31)/b18-11+ |
| InChIKey | GZSDPFHQTDBNQO-WOJGMQOQSA-N |
| XLogP | 3.62 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|