C24H23N3O6S3 — CID 71588353
2-[[(5E)-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-2-sulfanylidene-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 71588353) has the molecular formula C24H23N3O6S3 and a molecular weight of 545.66 g/mol. Its IUPAC name is 2-[[(5E)-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-2-sulfanylidene-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[[(5E)-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-2-sulfanylidene-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71588353 |
| Molecular Formula | C24H23N3O6S3 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-[[(5E)-5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-2-sulfanylidene-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | C=CCc1cccc(/C=C2/SC(=S)N(NC(=S)C(=O)Nc3cc(OC)c(OC)c(OC)c3)C2=O)c1O |
| InChI | InChI=1S/C24H23N3O6S3/c1-5-7-13-8-6-9-14(19(13)28)10-18-23(30)27(24(35)36-18)26-22(34)21(29)25-15-11-16(31-2)20(33-4)17(12-15)32-3/h5-6,8-12,28H,1,7H2,2-4H3,(H,25,29)(H,26,34)/b18-10+ |
| InChIKey | JWKTUYINTWKVKC-VCHYOVAHSA-N |
| XLogP | 3.82 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|