C7H9N5S — CID 71588530
2,3-dihydro-1H-benzotriazol-5-ylthiourea (PubChem CID 71588530) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-benzotriazol-5-ylthiourea.
| Compound Name | 2,3-dihydro-1H-benzotriazol-5-ylthiourea |
|---|---|
| PubChem CID | 71588530 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2,3-dihydro-1H-benzotriazol-5-ylthiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)NNN2 |
| InChI | InChI=1S/C7H9N5S/c8-7(13)9-4-1-2-5-6(3-4)11-12-10-5/h1-3,10-12H,(H3,8,9,13) |
| InChIKey | ZTCZLJGCMDJHHD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|