C13H13N2OS+ — CID 715890
(5S)-5-methyl-4,5-dihydro-[1,3]thiazolo[2,3-d][1,5]benzodiazepin-11-ium-6-carbaldehyde (PubChem CID 715890) has the molecular formula C13H13N2OS+ and a molecular weight of 245.33 g/mol. Its IUPAC name is (5S)-5-methyl-4,5-dihydro-[1,3]thiazolo[2,3-d][1,5]benzodiazepin-11-ium-6-carbaldehyde.
| Compound Name | (5S)-5-methyl-4,5-dihydro-[1,3]thiazolo[2,3-d][1,5]benzodiazepin-11-ium-6-carbaldehyde |
|---|---|
| PubChem CID | 715890 |
| Molecular Formula | C13H13N2OS+ |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (5S)-5-methyl-4,5-dihydro-[1,3]thiazolo[2,3-d][1,5]benzodiazepin-11-ium-6-carbaldehyde |
| SMILES | C[C@H]1Cc2scc[n+]2-c2ccccc2N1C=O |
| InChI | InChI=1S/C13H13N2OS/c1-10-8-13-14(6-7-17-13)11-4-2-3-5-12(11)15(10)9-16/h2-7,9-10H,8H2,1H3/q+1/t10-/m0/s1 |
| InChIKey | KSLKVNOVBQWOTM-JTQLQIEISA-N |
| XLogP | 1.93 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|