C8H6ClNOS — CID 87189009
3-chloro-2H-1,3-benzothiazole-2-carbaldehyde (PubChem CID 87189009) has the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. Its IUPAC name is 3-chloro-2H-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 3-chloro-2H-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 87189009 |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 3-chloro-2H-1,3-benzothiazole-2-carbaldehyde |
| SMILES | O=CC1Sc2ccccc2N1Cl |
| InChI | InChI=1S/C8H6ClNOS/c9-10-6-3-1-2-4-7(6)12-8(10)5-11/h1-5,8H |
| InChIKey | XMSMNXYAHCXPAS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|