C16H16N2S — CID 174784632
4-[2-(3-methyl-2H-1,3-benzothiazol-2-yl)ethenyl]aniline (PubChem CID 174784632) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-[2-(3-methyl-2H-1,3-benzothiazol-2-yl)ethenyl]aniline.
| Compound Name | 4-[2-(3-methyl-2H-1,3-benzothiazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 174784632 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[2-(3-methyl-2H-1,3-benzothiazol-2-yl)ethenyl]aniline |
| SMILES | CN1c2ccccc2SC1C=Cc1ccc(N)cc1 |
| InChI | InChI=1S/C16H16N2S/c1-18-14-4-2-3-5-15(14)19-16(18)11-8-12-6-9-13(17)10-7-12/h2-11,16H,17H2,1H3 |
| InChIKey | NMPIMHCLTMJSLI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|