About 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride
2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride (PubChem CID 173336628) has the molecular formula C19H18Cl2N2S
and a molecular weight of 377.34 g/mol. Its IUPAC name is 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride |
| PubChem CID | 173336628 |
| Molecular Formula | C19H18Cl2N2S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride |
| SMILES | CN1C(Cl)=CC(=CC2Sc3ccccc3N2C)c2ccccc21.Cl |
| InChI | InChI=1S/C19H17ClN2S.ClH/c1-21-15-8-4-3-7-14(15)13(11-18(21)20)12-19-22(2)16-9-5-6-10-17(16)23-19;/h3-12,19H,1-2H3;1H |
| InChIKey | WKGJEINXDBOWEZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride?
The IUPAC name of 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride (CID 173336628) is 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride is CN1C(Cl)=CC(=CC2Sc3ccccc3N2C)c2ccccc21.Cl.
What is the InChIKey of 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride?
The InChIKey is WKGJEINXDBOWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2S.ClH/c1-21-15-8-4-3-7-14(15)13(11-18(21)20)12-19-22(2)16-9-5-6-10-17(16)23-19;/h3-12,19H,1-2H3;1H.
What are the key properties of 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride?
2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride has a molecular weight of 377.34 g/mol, XLogP of 5.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 173336628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).