C19H18Cl2N2S — CID 173336628
2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride (PubChem CID 173336628) has the molecular formula C19H18Cl2N2S and a molecular weight of 377.34 g/mol. Its IUPAC name is 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride.
| Compound Name | 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 173336628 |
| Molecular Formula | C19H18Cl2N2S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[(2-chloro-1-methylquinolin-4-ylidene)methyl]-3-methyl-2H-1,3-benzothiazole;hydrochloride |
| SMILES | CN1C(Cl)=CC(=CC2Sc3ccccc3N2C)c2ccccc21.Cl |
| InChI | InChI=1S/C19H17ClN2S.ClH/c1-21-15-8-4-3-7-14(15)13(11-18(21)20)12-19-22(2)16-9-5-6-10-17(16)23-19;/h3-12,19H,1-2H3;1H |
| InChIKey | WKGJEINXDBOWEZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|