C10H13NO — CID 145236764
(2R)-2-methyl-2,3,4,5-tetrahydroindole-1-carbaldehyde (PubChem CID 145236764) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2R)-2-methyl-2,3,4,5-tetrahydroindole-1-carbaldehyde.
| Compound Name | (2R)-2-methyl-2,3,4,5-tetrahydroindole-1-carbaldehyde |
|---|---|
| PubChem CID | 145236764 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2R)-2-methyl-2,3,4,5-tetrahydroindole-1-carbaldehyde |
| SMILES | C[C@@H]1CC2=C(C=CCC2)N1C=O |
| InChI | InChI=1S/C10H13NO/c1-8-6-9-4-2-3-5-10(9)11(8)7-12/h3,5,7-8H,2,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | KIHGNYJZYPCMDH-MRVPVSSYSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|