C9H11NO4S — CID 141185864
(2-oxo-4,5-dihydro-3H-indol-1-yl) methanesulfonate (PubChem CID 141185864) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is (2-oxo-4,5-dihydro-3H-indol-1-yl) methanesulfonate.
| Compound Name | (2-oxo-4,5-dihydro-3H-indol-1-yl) methanesulfonate |
|---|---|
| PubChem CID | 141185864 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | (2-oxo-4,5-dihydro-3H-indol-1-yl) methanesulfonate |
| SMILES | CS(=O)(=O)ON1C(=O)CC2=C1C=CCC2 |
| InChI | InChI=1S/C9H11NO4S/c1-15(12,13)14-10-8-5-3-2-4-7(8)6-9(10)11/h3,5H,2,4,6H2,1H3 |
| InChIKey | GPHKHXRFWABQQR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |