C10H14N2O — CID 177026438
2-(dimethylamino)-4,5-dihydro-3H-isoindol-1-one (PubChem CID 177026438) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-(dimethylamino)-4,5-dihydro-3H-isoindol-1-one.
| Compound Name | 2-(dimethylamino)-4,5-dihydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 177026438 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(dimethylamino)-4,5-dihydro-3H-isoindol-1-one |
| SMILES | CN(C)N1CC2=C(C=CCC2)C1=O |
| InChI | InChI=1S/C10H14N2O/c1-11(2)12-7-8-5-3-4-6-9(8)10(12)13/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | YNXKVSIPKRRBFY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |