About [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid
[1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid (PubChem CID 70319257) has the molecular formula C14H19BN2O4
and a molecular weight of 290.13 g/mol. Its IUPAC name is [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid.
Molecular Properties
| Compound Name | [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid |
| PubChem CID | 70319257 |
| Molecular Formula | C14H19BN2O4 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid |
| SMILES | O=C1C2=C(CCC=C2)CN1CC(=O)N1CCCC1B(O)O |
| InChI | InChI=1S/C14H19BN2O4/c18-13(17-7-3-6-12(17)15(20)21)9-16-8-10-4-1-2-5-11(10)14(16)19/h2,5,12,20-21H,1,3-4,6-9H2 |
| InChIKey | VJBFNQHUXPOQBI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid?
The IUPAC name of [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid (CID 70319257) is [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid.
What is the SMILES notation for [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid?
The canonical SMILES for [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid is O=C1C2=C(CCC=C2)CN1CC(=O)N1CCCC1B(O)O.
What is the InChIKey of [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid?
The InChIKey is VJBFNQHUXPOQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BN2O4/c18-13(17-7-3-6-12(17)15(20)21)9-16-8-10-4-1-2-5-11(10)14(16)19/h2,5,12,20-21H,1,3-4,6-9H2.
What are the key properties of [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid?
[1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid has a molecular weight of 290.13 g/mol, XLogP of -0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(3-oxo-6,7-dihydro-1H-isoindol-2-yl)acetyl]pyrrolidin-2-yl]boronic acid is sourced from PubChem (CID 70319257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).