C24H23N3O2S — CID 71593690
(1E)-1-[(2-methoxyphenyl)methylidene]-3-(3-phenothiazin-10-ylpropyl)urea (PubChem CID 71593690) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (1E)-1-[(2-methoxyphenyl)methylidene]-3-(3-phenothiazin-10-ylpropyl)urea.
| Compound Name | (1E)-1-[(2-methoxyphenyl)methylidene]-3-(3-phenothiazin-10-ylpropyl)urea |
|---|---|
| PubChem CID | 71593690 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (1E)-1-[(2-methoxyphenyl)methylidene]-3-(3-phenothiazin-10-ylpropyl)urea |
| SMILES | COc1ccccc1/C=N/C(=O)NCCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H23N3O2S/c1-29-21-12-5-2-9-18(21)17-26-24(28)25-15-8-16-27-19-10-3-6-13-22(19)30-23-14-7-4-11-20(23)27/h2-7,9-14,17H,8,15-16H2,1H3,(H,25,28)/b26-17+ |
| InChIKey | SFAFQAGFXIUBJR-YZSQISJMSA-N |
| XLogP | 5.52 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|