About ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate
ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate (PubChem CID 71594223) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate |
| PubChem CID | 71594223 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate |
| SMILES | CCCc1nc2ccccc2c(S(C)(C)C#N)c1C(=O)OCC |
| InChI | InChI=1S/C18H22N2O2S/c1-5-9-15-16(18(21)22-6-2)17(23(3,4)12-19)13-10-7-8-11-14(13)20-15/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | YISBTMTUJCODFP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate?
The IUPAC name of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate (CID 71594223) is ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate?
The canonical SMILES for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate is CCCc1nc2ccccc2c(S(C)(C)C#N)c1C(=O)OCC.
What is the InChIKey of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate?
The InChIKey is YISBTMTUJCODFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c1-5-9-15-16(18(21)22-6-2)17(23(3,4)12-19)13-10-7-8-11-14(13)20-15/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate?
ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate has a molecular weight of 330.45 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-2-propylquinoline-3-carboxylate is sourced from PubChem (CID 71594223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).