About [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile
[(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile (PubChem CID 71594250) has the molecular formula C17H22N2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile.
Molecular Properties
| Compound Name | [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile |
| PubChem CID | 71594250 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile |
| SMILES | CCCCc1c(C)nc2ccccc2c1S(C)(C)C#N |
| InChI | InChI=1S/C17H22N2S/c1-5-6-9-14-13(2)19-16-11-8-7-10-15(16)17(14)20(3,4)12-18/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | HZPIAWBMOFRHIR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The IUPAC name of [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile (CID 71594250) is [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile.
What is the SMILES notation for [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The canonical SMILES for [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile is CCCCc1c(C)nc2ccccc2c1S(C)(C)C#N.
What is the InChIKey of [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
The InChIKey is HZPIAWBMOFRHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2S/c1-5-6-9-14-13(2)19-16-11-8-7-10-15(16)17(14)20(3,4)12-18/h7-8,10-11H,5-6,9H2,1-4H3.
What are the key properties of [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile?
[(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile has a molecular weight of 286.44 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-butyl-2-methylquinolin-4-yl)-dimethyl-λ4-sulfanyl]formonitrile is sourced from PubChem (CID 71594250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).