About ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate
ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate (PubChem CID 71594267) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate |
| PubChem CID | 71594267 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C)cc2c1S(C)(C)C#N |
| InChI | InChI=1S/C16H18N2O2S/c1-5-20-16(19)13-9-18-14-7-6-11(2)8-12(14)15(13)21(3,4)10-17/h6-9H,5H2,1-4H3 |
| InChIKey | UEAIWRZRUCQHCU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate?
The IUPAC name of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate (CID 71594267) is ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate?
The canonical SMILES for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate is CCOC(=O)c1cnc2ccc(C)cc2c1S(C)(C)C#N.
What is the InChIKey of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate?
The InChIKey is UEAIWRZRUCQHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-5-20-16(19)13-9-18-14-7-6-11(2)8-12(14)15(13)21(3,4)10-17/h6-9H,5H2,1-4H3.
What are the key properties of ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate?
ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate has a molecular weight of 302.40 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[cyano(dimethyl)-λ4-sulfanyl]-6-methylquinoline-3-carboxylate is sourced from PubChem (CID 71594267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).