C18H22N2O4 — CID 133399113
ethyl 4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]-6-methylquinoline-3-carboxylate (PubChem CID 133399113) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]-6-methylquinoline-3-carboxylate.
| Compound Name | ethyl 4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]-6-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133399113 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl 4-[[3-(hydroxymethyl)oxetan-3-yl]methylamino]-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C)cc2c1NCC1(CO)COC1 |
| InChI | InChI=1S/C18H22N2O4/c1-3-24-17(22)14-7-19-15-5-4-12(2)6-13(15)16(14)20-8-18(9-21)10-23-11-18/h4-7,21H,3,8-11H2,1-2H3,(H,19,20) |
| InChIKey | NTKMOOVBZLVJRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |