C15H14N2O — CID 71595317
(E)-N-(5-methyl-5H-1,2-oxazol-2-yl)-1-naphthalen-1-ylmethanimine (PubChem CID 71595317) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is (E)-N-(5-methyl-5H-1,2-oxazol-2-yl)-1-naphthalen-1-ylmethanimine.
| Compound Name | (E)-N-(5-methyl-5H-1,2-oxazol-2-yl)-1-naphthalen-1-ylmethanimine |
|---|---|
| PubChem CID | 71595317 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (E)-N-(5-methyl-5H-1,2-oxazol-2-yl)-1-naphthalen-1-ylmethanimine |
| SMILES | CC1C=CN(/N=C/c2cccc3ccccc23)O1 |
| InChI | InChI=1S/C15H14N2O/c1-12-9-10-17(18-12)16-11-14-7-4-6-13-5-2-3-8-15(13)14/h2-12H,1H3/b16-11+ |
| InChIKey | WRZMTQUXINCDFG-LFIBNONCSA-N |
| XLogP | 3.32 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|