C13H10N4S2 — CID 9295030
4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295030) has the molecular formula C13H10N4S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is 4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295030 |
| Molecular Formula | C13H10N4S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | S=c1[nH][nH]c(=S)n1/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C13H10N4S2/c18-12-15-16-13(19)17(12)14-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-8H,(H,15,18)(H,16,19)/b14-8- |
| InChIKey | HZZDNXSWAPRBII-ZSOIEALJSA-N |
| XLogP | 3.64 |
| TPSA | 48.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|