C12H18N2O2 — CID 7159546
N-methyl-N-[(1S,5R)-5,8,8-trimethyl-4-oxo-2-bicyclo[3.2.1]oct-2-enyl]nitrous amide (PubChem CID 7159546) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-methyl-N-[(1S,5R)-5,8,8-trimethyl-4-oxo-2-bicyclo[3.2.1]oct-2-enyl]nitrous amide.
| Compound Name | N-methyl-N-[(1S,5R)-5,8,8-trimethyl-4-oxo-2-bicyclo[3.2.1]oct-2-enyl]nitrous amide |
|---|---|
| PubChem CID | 7159546 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-methyl-N-[(1S,5R)-5,8,8-trimethyl-4-oxo-2-bicyclo[3.2.1]oct-2-enyl]nitrous amide |
| SMILES | CN(N=O)C1=CC(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C12H18N2O2/c1-11(2)8-5-6-12(11,3)10(15)7-9(8)14(4)13-16/h7-8H,5-6H2,1-4H3/t8-,12+/m1/s1 |
| InChIKey | XIXAPCKYCBFXNO-PELKAZGASA-N |
| XLogP | 2.51 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|