C18H33N3 — CID 71596059
(3R,5S,9R,11S)-3,11-dibutyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596059) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is (3R,5S,9R,11S)-3,11-dibutyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3R,5S,9R,11S)-3,11-dibutyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596059 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | (3R,5S,9R,11S)-3,11-dibutyl-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CCCC[C@@H]1C[C@@H]2CCC[C@@H]3C[C@H](CCCC)NC(=N1)N32 |
| InChI | InChI=1S/C18H33N3/c1-3-5-8-14-12-16-10-7-11-17-13-15(9-6-4-2)20-18(19-14)21(16)17/h14-17H,3-13H2,1-2H3,(H,19,20)/t14-,15+,16+,17- |
| InChIKey | MVIOWRQZJPXZPK-ZYGGUILKSA-N |
| XLogP | 4.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |