C15H27N3 — CID 71596181
10-methyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71596181) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 10-methyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | 10-methyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71596181 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 10-methyl-6-pentyl-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | CCCCCC1CC2CCC3CC(C)NC(=N1)N23 |
| InChI | InChI=1S/C15H27N3/c1-3-4-5-6-12-10-14-8-7-13-9-11(2)16-15(17-12)18(13)14/h11-14H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | QUHWOQFRSXUNPM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|