C27H51N3 — CID 71596180
(1R,4S,6R,10S)-6,10-di(nonyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71596180) has the molecular formula C27H51N3 and a molecular weight of 417.73 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6,10-di(nonyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6,10-di(nonyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71596180 |
| Molecular Formula | C27H51N3 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 417.41 |
| IUPAC Name | (1R,4S,6R,10S)-6,10-di(nonyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | CCCCCCCCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](CCCCCCCCC)NC(=N1)N32 |
| InChI | InChI=1S/C27H51N3/c1-3-5-7-9-11-13-15-17-23-21-25-19-20-26-22-24(29-27(28-23)30(25)26)18-16-14-12-10-8-6-4-2/h23-26H,3-22H2,1-2H3,(H,28,29)/t23-,24+,25+,26- |
| InChIKey | USOJEEVTCWTHED-FATVKVNYSA-N |
| XLogP | 7.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|