C21H39N3 — CID 71595965
(1R,4S,6R,10S)-6,10-bis(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71595965) has the molecular formula C21H39N3 and a molecular weight of 333.56 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6,10-bis(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6,10-bis(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71595965 |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.31 |
| IUPAC Name | (1R,4S,6R,10S)-6,10-bis(4-methylpentyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | CC(C)CCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](CCCC(C)C)NC(=N1)N32 |
| InChI | InChI=1S/C21H39N3/c1-15(2)7-5-9-17-13-19-11-12-20-14-18(10-6-8-16(3)4)23-21(22-17)24(19)20/h15-20H,5-14H2,1-4H3,(H,22,23)/t17-,18+,19+,20- |
| InChIKey | GSJKPBOBPBUEJE-JVSBHGNQSA-N |
| XLogP | 4.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |